CAS 1119449-61-4
:3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-ethyl-N-methylbenzamide
Description:
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-ethyl-N-methylbenzamide is a chemical compound characterized by its unique structure, which includes an oxadiazole ring and a benzamide moiety. The presence of the chloromethyl group enhances its reactivity, potentially allowing for further chemical modifications. This compound is likely to exhibit properties typical of both oxadiazoles and amides, such as moderate to high stability under standard conditions and potential biological activity, which may include antimicrobial or anticancer properties. The ethyl and methyl substituents on the nitrogen atoms contribute to its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which could be relevant in its biological activity or in the formation of complexes with other molecules. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and material science.
Formula:C13H14ClN3O2
InChI:InChI=1S/C13H14ClN3O2/c1-3-17(2)13(18)10-6-4-5-9(7-10)12-15-11(8-14)19-16-12/h4-7H,3,8H2,1-2H3
InChI key:InChIKey=PMABTQCCWOAMRD-UHFFFAOYSA-N
SMILES:C(N(CC)C)(=O)C=1C=C(C=CC1)C=2N=C(CCl)ON2
Synonyms:- Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-ethyl-N-methyl-
- 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-ethyl-N-methylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.