CAS 1119449-62-5

4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclohexyl-N-methylbenzamide

Description:

4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclohexyl-N-methylbenzamide is a chemical compound characterized by its unique structure, which includes an oxadiazole ring, a chloromethyl group, and a benzamide moiety. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The chloromethyl group may enhance reactivity and facilitate further chemical modifications. The cyclohexyl and methyl groups attached to the nitrogen atoms in the benzamide structure can influence the compound's lipophilicity and solubility, which are critical for its bioavailability and interaction with biological targets. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological data would be necessary to confirm these effects. Additionally, its stability, melting point, and solubility in various solvents would be important characteristics to consider for practical applications in research or pharmaceuticals. Safety data, including toxicity and handling precautions, should also be reviewed before use.

Formula: C₁₇H₂₀ClN₃O₂

InChI: InChI=1S/C17H20ClN3O2/c1-21(14-5-3-2-4-6-14)17(22)13-9-7-12(8-10-13)16-19-15(11-18)23-20-16/h7-10,14H,2-6,11H2,1H3

InChI key: InChIKey=VSOMEIXMMUEPTA-UHFFFAOYSA-N

SMILES: C(Cl)C1=NC(C2=CC=C(C(N(C)C3CCCCC3)=O)C=C2)=NO1

Synonyms:

• Benzamide, 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclohexyl-N-methyl-
• 4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclohexyl-N-methylbenzamide