CAS 1119449-65-8

3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxy-N-methylbenzamide

Description:

3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxy-N-methylbenzamide is a chemical compound characterized by its unique structural features, which include an oxadiazole ring and a methoxy-substituted benzamide moiety. The presence of the chloromethyl group enhances its reactivity, potentially allowing for further chemical modifications or interactions. This compound may exhibit biological activity due to its structural components, which can influence its interaction with biological targets. The oxadiazole ring is known for its role in various pharmacological applications, often contributing to the compound's overall efficacy. Additionally, the methoxy group can affect the compound's solubility and lipophilicity, influencing its pharmacokinetic properties. As with many synthetic organic compounds, the stability, reactivity, and potential toxicity of this substance would depend on its specific chemical environment and conditions. Overall, this compound represents a class of heterocyclic compounds that may have applications in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₂ClN₃O₃

InChI: InChI=1S/C12H12ClN3O3/c1-14-12(17)7-3-4-9(18-2)8(5-7)11-15-10(6-13)19-16-11/h3-5H,6H2,1-2H3,(H,14,17)

InChI key: InChIKey=MDCNSTWJLSWFQF-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(C(NC)=O)C=C1)C=2N=C(CCl)ON2

Synonyms:

• Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxy-N-methyl-
• 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxy-N-methylbenzamide