CymitQuimica logo

CAS 1119449-66-9

:

N-Methyl-N-(1-methyl-3-pyrrolidinyl)-β-alanine methyl ester

Description:
N-Methyl-N-(1-methyl-3-pyrrolidinyl)-β-alanine methyl ester is a chemical compound characterized by its unique structure, which includes a β-alanine backbone modified with a methyl ester and a pyrrolidine ring. This compound features a nitrogen atom in the pyrrolidine ring that is methylated, contributing to its overall stability and solubility in organic solvents. The presence of the methyl ester group enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is likely to exhibit properties typical of amino acids and their derivatives, such as being polar and capable of forming hydrogen bonds. Its molecular structure suggests potential interactions with biological systems, making it of interest for research in neuropharmacology or as a building block in peptide synthesis. As with many chemical substances, safety data and handling precautions should be considered, as the specific biological effects and toxicity profiles would need to be evaluated through empirical studies.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-11-6-4-9(8-11)12(2)7-5-10(13)14-3/h9H,4-8H2,1-3H3
InChI key:InChIKey=XVVRJVMESFWJGP-UHFFFAOYSA-N
SMILES:N(CCC(OC)=O)(C)C1CN(C)CC1
Synonyms:
  • β-Alanine, N-methyl-N-(1-methyl-3-pyrrolidinyl)-, methyl ester
  • N-Methyl-N-(1-methyl-3-pyrrolidinyl)-β-alanine methyl ester
  • methyl 3-[methyl(1-methylpyrrolidin-3-yl)amino]propanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.