CAS 1119449-72-7
:α-Cyclopentylhexahydro-1H-azepine-1-acetonitrile
Description:
α-Cyclopentylhexahydro-1H-azepine-1-acetonitrile is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and a hexahydroazepine ring. This compound features a nitrile functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the azepine ring indicates that it may exhibit properties typical of nitrogen-containing heterocycles, such as potential biological activity or utility in pharmaceuticals. The cyclopentyl substituent can influence the compound's steric and electronic properties, potentially affecting its solubility and interaction with biological targets. Additionally, the acetonitrile moiety may enhance its polarity, making it suitable for various chemical reactions or as a solvent in certain applications. Overall, α-Cyclopentylhexahydro-1H-azepine-1-acetonitrile represents a versatile structure that may be of interest in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C13H22N2
InChI:InChI=1S/C13H22N2/c14-11-13(12-7-3-4-8-12)15-9-5-1-2-6-10-15/h12-13H,1-10H2
InChI key:InChIKey=MDVRVFBOHNBGHG-UHFFFAOYSA-N
SMILES:C(C#N)(N1CCCCCC1)C2CCCC2
Synonyms:- α-Cyclopentylhexahydro-1H-azepine-1-acetonitrile
- 1H-Azepine-1-acetonitrile, α-cyclopentylhexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
