CAS 1119449-73-8: Methyl 3-[(hydroxyamino)iminomethyl]-4-methoxybenzoate

Description: Methyl 3-[(hydroxyamino)iminomethyl]-4-methoxybenzoate, identified by its CAS number 1119449-73-8, is a chemical compound that features a methoxy group and a hydroxyamino functional group, contributing to its unique reactivity and properties. This compound is characterized by its aromatic structure, which includes a benzoate moiety, enhancing its potential for various chemical interactions. The presence of the hydroxyamino group suggests that it may participate in hydrogen bonding, influencing its solubility and stability in different solvents. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially making it more reactive in electrophilic substitution reactions. Methyl 3-[(hydroxyamino)iminomethyl]-4-methoxybenzoate may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from medicinal chemistry to materials science, depending on its specific properties and reactivity. Further studies would be necessary to fully elucidate its behavior in various chemical environments.

Formula: C₁₀H₁₂N₂O₄

InChI: InChI=1S/C10H12N2O4/c1-15-8-4-3-6(10(13)16-2)5-7(8)9(11)12-14/h3-5,14H,1-2H3,(H2,11,12)

InChI key: InChIKey=NMLAUBDOPKTXCE-UHFFFAOYSA-N

SMILES: O=C(OC)C1=CC=C(OC)C(=C1)C(=N)NO

Synonyms:

• Methyl 3-[(hydroxyamino)iminomethyl]-4-methoxybenzoate
• Benzoic acid, 3-[(hydroxyamino)iminomethyl]-4-methoxy-, methyl ester

methyl 3-[(E)-amino(hydroxyimino)methyl]-4-methoxybenzoate

CAS: 1119449-73-8

• Molecular weight: 224.216

Methyl 3-[(E)-amino(hydroxyimino)methyl]-4-methoxybenzoate

CAS: 1119449-73-8

Please enquire for more information about Methyl 3-[(E)-amino(hydroxyimino)methyl]-4-methoxybenzoate including the price, delivery time and more …

• Formula: C₁₀H₁₂N₂O₄
• Purity: Min. 95%
• Molecular weight: 224.21 g/mol