
CAS 1119449-74-9
:3-[[(4-Amino-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxybenzaldehyde
Description:
3-[[(4-Amino-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxybenzaldehyde is a chemical compound characterized by its unique structural features, which include a benzaldehyde moiety, a methoxy group, and a triazole ring. The presence of the amino group on the triazole ring suggests potential for hydrogen bonding and reactivity, making it a candidate for various biological applications. The thioether linkage contributes to its stability and may influence its solubility and reactivity in different environments. This compound may exhibit properties such as antimicrobial or antifungal activity, which are common in triazole derivatives. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the methoxy group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Overall, this compound's characteristics suggest it could be valuable in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H12N4O2S
InChI:InChI=1S/C11H12N4O2S/c1-17-10-3-2-8(5-16)4-9(10)6-18-11-14-13-7-15(11)12/h2-5,7H,6,12H2,1H3
InChI key:InChIKey=GHYIUTXEKITELR-UHFFFAOYSA-N
SMILES:C(SC=1N(N)C=NN1)C2=C(OC)C=CC(C=O)=C2
Synonyms:- 3-[[(4-Amino-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxybenzaldehyde
- Benzaldehyde, 3-[[(4-amino-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.