CymitQuimica logo

CAS 1119449-76-1

:

3-[4-Methoxy-3-[(2-methyl-1-piperidinyl)methyl]phenyl]-2-propenoic acid

Description:
3-[4-Methoxy-3-[(2-methyl-1-piperidinyl)methyl]phenyl]-2-propenoic acid, identified by its CAS number 1119449-76-1, is a chemical compound characterized by its complex structure, which includes a propenoic acid moiety and a substituted phenyl group. The presence of a methoxy group and a piperidine derivative contributes to its potential biological activity, possibly influencing its solubility and reactivity. This compound may exhibit properties typical of both organic acids and aromatic compounds, such as acidity due to the carboxylic acid functional group and potential for π-π interactions due to the aromatic rings. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The piperidine ring may enhance its ability to interact with biological targets, making it a candidate for further investigation in drug discovery. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C17H23NO3
InChI:InChI=1S/C17H23NO3/c1-13-5-3-4-10-18(13)12-15-11-14(7-9-17(19)20)6-8-16(15)21-2/h6-9,11,13H,3-5,10,12H2,1-2H3,(H,19,20)
InChI key:InChIKey=RTOZCLWZMGDZBM-UHFFFAOYSA-N
SMILES:C(C1=C(OC)C=CC(C=CC(O)=O)=C1)N2C(C)CCCC2
Synonyms:
  • 3-[4-Methoxy-3-[(2-methyl-1-piperidinyl)methyl]phenyl]-2-propenoic acid
  • 2-Propenoic acid, 3-[4-methoxy-3-[(2-methyl-1-piperidinyl)methyl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.