CAS 1119449-78-3

3-[3-[(2-Ethyl-1H-imidazol-1-yl)methyl]-4-methoxyphenyl]-2-propenoic acid

Description:

3-[3-[(2-Ethyl-1H-imidazol-1-yl)methyl]-4-methoxyphenyl]-2-propenoic acid, with the CAS number 1119449-78-3, is a chemical compound characterized by its complex structure, which includes an imidazole ring, a methoxy group, and a propenoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the imidazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The methoxy group can influence the compound's solubility and lipophilicity, while the propenoic acid functionality may participate in various chemical reactions, such as polymerization or esterification. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further research in drug development or other applications in organic synthesis. However, detailed studies would be necessary to fully elucidate its characteristics and potential uses.

Formula: C₁₆H₁₈N₂O₃

InChI: InChI=1S/C16H18N2O3/c1-3-15-17-8-9-18(15)11-13-10-12(5-7-16(19)20)4-6-14(13)21-2/h4-10H,3,11H2,1-2H3,(H,19,20)

InChI key: InChIKey=ZFDWIDPBIBARMQ-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(C=CC(O)=O)=C1)N2C(CC)=NC=C2

Synonyms:

• 2-Propenoic acid, 3-[3-[(2-ethyl-1H-imidazol-1-yl)methyl]-4-methoxyphenyl]-
• 3-[3-[(2-Ethyl-1H-imidazol-1-yl)methyl]-4-methoxyphenyl]-2-propenoic acid