CAS 1119449-94-3
:1-(Methylsulfonyl)-3-piperidineethanamine
Description:
1-(Methylsulfonyl)-3-piperidineethanamine, identified by its CAS number 1119449-94-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a methylsulfonyl group, which contributes to its unique properties, including potential solubility in polar solvents and the ability to participate in various chemical reactions. The presence of the amine functional group suggests that it may exhibit basic properties and can engage in hydrogen bonding, influencing its reactivity and interactions with biological systems. Typically, compounds of this nature are studied for their potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The specific arrangement of atoms and functional groups in 1-(Methylsulfonyl)-3-piperidineethanamine may impart distinct biological activities, making it a subject of interest in research aimed at discovering new therapeutic agents. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C8H18N2O2S
InChI:InChI=1S/C8H18N2O2S/c1-13(11,12)10-6-2-3-8(7-10)4-5-9/h8H,2-7,9H2,1H3
InChI key:InChIKey=USNNRJSCKORARL-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)N1CC(CCN)CCC1
Synonyms:- 2-[1-(Methylsulfonyl)piperidin-3-yl]ethanamine
- 3-Piperidineethanamine, 1-(methylsulfonyl)-
- 2-(1-Methylsulfonylpiperidin-3-yl)ethanamine
- 1-(Methylsulfonyl)-3-piperidineethanamine
- 2-(1-Methanesulfonylpiperidin-3-yl)ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.