CAS 1119449-96-5
:1,2-Dihydro-3-(1H-indol-3-yl)-2-(2-methoxyethyl)-1-oxo-4-isoquinolinecarboxylic acid
Description:
1,2-Dihydro-3-(1H-indol-3-yl)-2-(2-methoxyethyl)-1-oxo-4-isoquinolinecarboxylic acid is a complex organic compound characterized by its unique structural features, which include an isoquinoline framework and an indole moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with various biological targets, which may contribute to its pharmacological properties. The presence of functional groups such as the carboxylic acid and methoxyethyl side chain can influence its solubility, stability, and reactivity. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Due to its intricate structure, it may also participate in various chemical reactions, including esterification and amidation, which could be relevant for further synthetic modifications or applications in drug development. Overall, this compound represents a fascinating area of study within the realm of organic and medicinal chemistry.
Formula:C21H18N2O4
InChI:InChI=1S/C21H18N2O4/c1-27-11-10-23-19(16-12-22-17-9-5-4-6-13(16)17)18(21(25)26)14-7-2-3-8-15(14)20(23)24/h2-9,12,22H,10-11H2,1H3,(H,25,26)
InChI key:InChIKey=AQOYTHHXRKBOTE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N(CCOC)C(=O)C=2C1=CC=CC2)C=3C=4C(NC3)=CC=CC4
Synonyms:- 1,2-Dihydro-3-(1H-indol-3-yl)-2-(2-methoxyethyl)-1-oxo-4-isoquinolinecarboxylic acid
- 4-Isoquinolinecarboxylic acid, 1,2-dihydro-3-(1H-indol-3-yl)-2-(2-methoxyethyl)-1-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.