CymitQuimica logo

CAS 111945-86-9

:

3-Hydroxy-5-[4-(1-methylethyl)phenyl]-2-cyclohexen-1-one

Description:
3-Hydroxy-5-[4-(1-methylethyl)phenyl]-2-cyclohexen-1-one, with the CAS number 111945-86-9, is an organic compound characterized by its unique structural features, including a cyclohexenone core and a hydroxyl group. This compound exhibits properties typical of phenolic compounds, such as potential antioxidant activity due to the presence of the hydroxyl group. The isopropyl-substituted phenyl group enhances its lipophilicity, which may influence its solubility and reactivity in various solvents. The compound's structure suggests it may participate in various chemical reactions, including electrophilic substitutions and hydrogen bonding interactions. Additionally, its potential applications could span across fields such as pharmaceuticals, where it may serve as a precursor or intermediate in the synthesis of biologically active molecules. The stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 3-Hydroxy-5-[4-(1-methylethyl)phenyl]-2-cyclohexen-1-one represents a versatile compound with potential utility in chemical synthesis and research.
Formula:C15H18O2
InChI:InChI=1S/C15H18O2/c1-10(2)11-3-5-12(6-4-11)13-7-14(16)9-15(17)8-13/h3-6,9-10,13,16H,7-8H2,1-2H3
InChI key:InChIKey=RXEIWXKGLKGRIR-UHFFFAOYSA-N
SMILES:O=C1CC(C2=CC=C(C(C)C)C=C2)CC(O)=C1
Synonyms:
  • 3-Hydroxy-5-[4-(1-methylethyl)phenyl]-2-cyclohexen-1-one
  • 2-Cyclohexen-1-one, 3-hydroxy-5-[4-(1-methylethyl)phenyl]-
  • 3-Hydroxy-5-(4-propan-2-ylphenyl)cyclohex-2-en-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.