CAS 1119450-03-1

1-[[5-Methyl-2-(3-methylphenyl)-4-oxazolyl]methyl]-4-piperidinecarboxylic acid

Description:

1-[[5-Methyl-2-(3-methylphenyl)-4-oxazolyl]methyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring and an oxazole moiety. The presence of the piperidine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The oxazole ring contributes to the compound's stability and may influence its pharmacological properties. Additionally, the methyl groups attached to the aromatic and oxazole rings can enhance lipophilicity, potentially affecting the compound's solubility and permeability. This compound may exhibit specific biological activities, making it of interest for further research in drug development. Its unique structural features and functional groups suggest that it could be investigated for various therapeutic applications, although detailed studies would be necessary to elucidate its mechanism of action and efficacy. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₈H₂₂N₂O₃

InChI: InChI=1S/C18H22N2O3/c1-12-4-3-5-15(10-12)17-19-16(13(2)23-17)11-20-8-6-14(7-9-20)18(21)22/h3-5,10,14H,6-9,11H2,1-2H3,(H,21,22)

InChI key: InChIKey=VZNHZJAGUNBDBV-UHFFFAOYSA-N

SMILES: C(C=1N=C(OC1C)C2=CC(C)=CC=C2)N3CCC(C(O)=O)CC3

Synonyms:

• 1-[[5-Methyl-2-(3-methylphenyl)-4-oxazolyl]methyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[[5-methyl-2-(3-methylphenyl)-4-oxazolyl]methyl]-
• 1-[[5-Methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]methyl]piperidine-4-carboxylic acid