CAS 1119450-04-2

2-Bromo-N-cyclopentyl-N-methylbenzenemethanamine

Description:

2-Bromo-N-cyclopentyl-N-methylbenzenemethanamine, identified by its CAS number 1119450-04-2, is a chemical compound that belongs to the class of amines. Its structure features a bromine atom attached to a benzene ring, which is further substituted with a cyclopentyl group and a methylamine moiety. This compound is characterized by its potential biological activity, which may include interactions with neurotransmitter systems, given its amine functional group. The presence of the bromine atom can influence its reactivity and solubility, while the cyclopentyl group may contribute to its steric properties. Typically, compounds of this nature are studied for their pharmacological properties, and their synthesis may involve various organic reactions, including halogenation and amination. Safety and handling precautions are essential when working with such substances, as they may exhibit toxicity or other hazardous characteristics. Overall, 2-Bromo-N-cyclopentyl-N-methylbenzenemethanamine represents a unique structure that could have implications in medicinal chemistry and drug development.

Formula: C₁₃H₁₈BrN

InChI: InChI=1S/C13H18BrN/c1-15(12-7-3-4-8-12)10-11-6-2-5-9-13(11)14/h2,5-6,9,12H,3-4,7-8,10H2,1H3

InChI key: InChIKey=ZGFIVFAJZNCZOU-UHFFFAOYSA-N

SMILES: C(N(C)C1CCCC1)C2=C(Br)C=CC=C2

Synonyms:

• 2-Bromo-N-cyclopentyl-N-methylbenzenemethanamine
• Benzenemethanamine, 2-bromo-N-cyclopentyl-N-methyl-