CAS 1119450-10-0
:4-Methoxy-3-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]benzaldehyde
Description:
4-Methoxy-3-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]benzaldehyde is a chemical compound characterized by its complex structure, which includes a benzaldehyde moiety, methoxy groups, and a benzimidazole derivative. The presence of the methoxy groups contributes to its solubility and reactivity, while the thioether linkage introduces unique properties that may influence its biological activity. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic rings and polar functional groups. Its potential applications may include roles in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of the benzimidazole ring, which is known for various biological activities. The compound's stability, reactivity, and interactions with biological targets would depend on its specific functional groups and overall molecular conformation. As with many organic compounds, it is essential to handle it with care, considering safety protocols related to its chemical properties and potential toxicity.
Formula:C17H16N2O3S
InChI:InChI=1S/C17H16N2O3S/c1-21-13-4-5-14-15(8-13)19-17(18-14)23-10-12-7-11(9-20)3-6-16(12)22-2/h3-9H,10H2,1-2H3,(H,18,19)
InChI key:InChIKey=YZJXMVKZYIBEMS-UHFFFAOYSA-N
SMILES:S(CC1=C(OC)C=CC(C=O)=C1)C=2NC=3C(N2)=CC(OC)=CC3
Synonyms:- Benzaldehyde, 4-methoxy-3-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]-
- 4-Methoxy-3-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.