CAS 1119450-11-1
:3,5,6-Trifluoro-2-pyridineacetic acid
Description:
3,5,6-Trifluoro-2-pyridineacetic acid is a fluorinated pyridine derivative characterized by the presence of three fluorine atoms and a carboxylic acid functional group. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The trifluoromethyl groups enhance its lipophilicity and may influence its reactivity and interaction with biological targets. The presence of the carboxylic acid group provides acidic properties, allowing for potential salt formation and participation in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties due to the electron-withdrawing effects of the fluorine atoms, which can affect the electronic distribution within the molecule. Additionally, its structural characteristics suggest potential applications in medicinal chemistry, agrochemicals, or as a building block in organic synthesis. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C7H4F3NO2
InChI:InChI=1S/C7H4F3NO2/c8-3-1-4(9)7(10)11-5(3)2-6(12)13/h1H,2H2,(H,12,13)
InChI key:InChIKey=BKXRMAATAYYXEW-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(F)C=C(F)C(F)=N1
Synonyms:- 2-Pyridineacetic acid, 3,5,6-trifluoro-
- 3,5,6-Trifluoro-2-pyridineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.