CAS 1119450-12-2

N2,N2,5-Trimethyl-1H-indole-2,3-diethanamine

Description:

N2,N2,5-Trimethyl-1H-indole-2,3-diethanamine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features three methyl groups attached to the nitrogen atoms at the 2 and 5 positions of the indole ring, contributing to its unique properties. The presence of diethanamine groups indicates that it has two ethylamine substituents, which can influence its reactivity and solubility. Generally, compounds of this nature may exhibit biological activity, potentially interacting with various receptors or enzymes in biological systems. The molecular structure suggests that it may have applications in medicinal chemistry or as a research tool in pharmacology. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation through empirical studies and literature review. As with any chemical substance, proper handling and safety protocols should be observed due to potential hazards associated with its use.

Formula: C₁₅H₂₃N₃

InChI: InChI=1S/C15H23N3/c1-11-4-5-14-13(10-11)12(6-8-16)15(17-14)7-9-18(2)3/h4-5,10,17H,6-9,16H2,1-3H3

InChI key: InChIKey=SFUMZHXMXGEGFC-UHFFFAOYSA-N

SMILES: C(CN)C=1C=2C(NC1CCN(C)C)=CC=C(C)C2

Synonyms:

• 1H-Indole-2,3-diethanamine, N2,N2,5-trimethyl-
• N2,N2,5-Trimethyl-1H-indole-2,3-diethanamine