CymitQuimica logo

CAS 1119450-13-3

:

2,3-Dihydro-9-methoxy-2-(3-methoxyphenyl)-1,4-benzoxazepine-4(5H)-acetic acid

Description:
2,3-Dihydro-9-methoxy-2-(3-methoxyphenyl)-1,4-benzoxazepine-4(5H)-acetic acid is a chemical compound characterized by its complex structure, which includes a benzoxazepine core. This compound features a methoxy group at the 9-position and a 3-methoxyphenyl substituent, contributing to its unique properties. The presence of the acetic acid moiety suggests potential acidic behavior, which may influence its solubility and reactivity. The benzoxazepine framework is known for its biological activity, often associated with neuroactive properties, making this compound of interest in medicinal chemistry. Its molecular structure may allow for interactions with various biological targets, potentially leading to therapeutic applications. The compound's specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. Overall, 2,3-Dihydro-9-methoxy-2-(3-methoxyphenyl)-1,4-benzoxazepine-4(5H)-acetic acid represents a class of compounds that may exhibit significant pharmacological potential due to their structural features.
Formula:C19H21NO5
InChI:InChI=1S/C19H21NO5/c1-23-15-7-3-5-13(9-15)17-11-20(12-18(21)22)10-14-6-4-8-16(24-2)19(14)25-17/h3-9,17H,10-12H2,1-2H3,(H,21,22)
InChI key:InChIKey=ITFUWNGLFHZZSX-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(CN(CC(O)=O)CC(O2)C3=CC(OC)=CC=C3)=CC=C1
Synonyms:
  • 2,3-Dihydro-9-methoxy-2-(3-methoxyphenyl)-1,4-benzoxazepine-4(5H)-acetic acid
  • 1,4-Benzoxazepine-4(5H)-acetic acid, 2,3-dihydro-9-methoxy-2-(3-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.