CymitQuimica logo

CAS 1119450-14-4

:

1-Ethyl-2-methyl-1H-benzimidazole-5-acetic acid

Description:
1-Ethyl-2-methyl-1H-benzimidazole-5-acetic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with an ethyl group at the 1-position and a methyl group at the 2-position, along with an acetic acid functional group at the 5-position. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. It may display biological activity, potentially serving as a pharmaceutical intermediate or active ingredient, although specific biological properties would depend on further studies. The presence of both the benzimidazole and acetic acid moieties suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Its molecular interactions, stability, and reactivity would be influenced by the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-3-14-8(2)13-10-6-9(7-12(15)16)4-5-11(10)14/h4-6H,3,7H2,1-2H3,(H,15,16)
InChI key:InChIKey=NSMBWZGCHADSEB-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=CC(CC(O)=O)=CC2)N=C1C
Synonyms:
  • 1H-Benzimidazole-5-acetic acid, 1-ethyl-2-methyl-
  • 1-Ethyl-2-methyl-1H-benzimidazole-5-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.