CAS 1119450-17-7

Ethyl 1-[(3-methylphenyl)methyl]-1H-imidazole-2-carboxylate

Description:

Ethyl 1-[(3-methylphenyl)methyl]-1H-imidazole-2-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the 3-methylphenyl group indicates that it has a substituted aromatic system, which can influence its reactivity and interaction with biological targets. The imidazole moiety is known for its role in various biological processes and can participate in hydrogen bonding due to the nitrogen atoms. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting enzyme inhibition or receptor modulation. Overall, the combination of the imidazole ring and the aromatic substituent provides a unique profile that could be explored for various chemical and biological applications.

Formula: C₁₄H₁₆N₂O₂

InChI: InChI=1S/C14H16N2O2/c1-3-18-14(17)13-15-7-8-16(13)10-12-6-4-5-11(2)9-12/h4-9H,3,10H2,1-2H3

InChI key: InChIKey=LDUIAKMLJOYDHI-UHFFFAOYSA-N

SMILES: C(N1C(C(OCC)=O)=NC=C1)C2=CC(C)=CC=C2

Synonyms:

• Ethyl 1-[(3-methylphenyl)methyl]-1H-imidazole-2-carboxylate
• 1H-Imidazole-2-carboxylic acid, 1-[(3-methylphenyl)methyl]-, ethyl ester
• ethyl 1-(3-methylbenzyl)-1H-imidazole-2-carboxylate