CymitQuimica logo

CAS 1119450-23-5

:

2-Bromo-N-butyl-N-methylbutanamide

Description:
2-Bromo-N-butyl-N-methylbutanamide is an organic compound characterized by the presence of a bromine atom, a butyl group, and a methyl group attached to a butanamide backbone. This compound features a carbon chain that contributes to its hydrophobic properties, while the amide functional group introduces polar characteristics, allowing for potential hydrogen bonding. The bromine substituent enhances the compound's reactivity, making it useful in various synthetic applications, including organic synthesis and medicinal chemistry. Its molecular structure suggests that it may exhibit moderate solubility in organic solvents and limited solubility in water due to the balance between its hydrophobic and hydrophilic regions. Additionally, the presence of the amide group may impart some degree of stability to the molecule, influencing its reactivity and interactions with other chemical species. Overall, 2-Bromo-N-butyl-N-methylbutanamide is a versatile compound with potential applications in research and industry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C9H18BrNO
InChI:InChI=1S/C9H18BrNO/c1-4-6-7-11(3)9(12)8(10)5-2/h8H,4-7H2,1-3H3
InChI key:InChIKey=FAIJOPYLMDURBM-UHFFFAOYSA-N
SMILES:C(N(CCCC)C)(C(CC)Br)=O
Synonyms:
  • Butanamide, 2-bromo-N-butyl-N-methyl-
  • 2-Bromo-N-butyl-N-methylbutanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.