CymitQuimica logo

CAS 1119450-27-9

:

1-Butyl-1,2,3,4-tetrahydro-N-[3-(4-morpholinyl)propyl]-6-quinolinemethanamine

Description:
1-Butyl-1,2,3,4-tetrahydro-N-[3-(4-morpholinyl)propyl]-6-quinolinemethanamine, identified by its CAS number 1119450-27-9, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a complex molecular structure characterized by a quinoline ring fused with a tetrahydro moiety, which contributes to its potential biological activity. The presence of a butyl group and a morpholinyl propyl substituent suggests that it may exhibit lipophilic properties, enhancing its ability to penetrate biological membranes. The compound is likely to interact with various biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, and its biological effects would require thorough investigation through experimental studies.
Formula:C21H35N3O
InChI:InChI=1S/C21H35N3O/c1-2-3-11-24-12-4-6-20-17-19(7-8-21(20)24)18-22-9-5-10-23-13-15-25-16-14-23/h7-8,17,22H,2-6,9-16,18H2,1H3
InChI key:InChIKey=ZLIYXCYYCFHTPN-UHFFFAOYSA-N
SMILES:C(CCC)N1C=2C(=CC(CNCCCN3CCOCC3)=CC2)CCC1
Synonyms:
  • 1-Butyl-1,2,3,4-tetrahydro-N-[3-(4-morpholinyl)propyl]-6-quinolinemethanamine
  • 6-Quinolinemethanamine, 1-butyl-1,2,3,4-tetrahydro-N-[3-(4-morpholinyl)propyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.