CAS 1119450-28-0
:1,2,3,4-Tetrahydro-N-(1-methylpropyl)-1-propyl-6-quinolinemethanamine
Description:
1,2,3,4-Tetrahydro-N-(1-methylpropyl)-1-propyl-6-quinolinemethanamine, identified by its CAS number 1119450-28-0, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a tetrahydroquinoline core, which is a bicyclic structure known for its presence in various biologically active compounds. The presence of the N-(1-methylpropyl) and 1-propyl substituents indicates that it has a branched alkyl amine structure, which can influence its pharmacological properties, including potential interactions with biological targets. The compound may exhibit properties such as moderate lipophilicity due to its hydrophobic alkyl chains, which can affect its solubility and permeability in biological systems. Additionally, the presence of the amine functional group suggests potential for hydrogen bonding and interaction with receptors or enzymes. While specific biological activities or applications may not be widely documented, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects.
Formula:C17H28N2
InChI:InChI=1S/C17H28N2/c1-4-10-19-11-6-7-16-12-15(8-9-17(16)19)13-18-14(3)5-2/h8-9,12,14,18H,4-7,10-11,13H2,1-3H3
InChI key:InChIKey=ICRROYQRGSIMKQ-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(=CC(CNC(CC)C)=CC2)CCC1
Synonyms:- 6-Quinolinemethanamine, 1,2,3,4-tetrahydro-N-(1-methylpropyl)-1-propyl-
- 1,2,3,4-Tetrahydro-N-(1-methylpropyl)-1-propyl-6-quinolinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.