CAS 1119450-31-5

N1-(3-Ethoxypropyl)-N1-(2-furanylmethyl)-1,3-propanediamine

Description:

N1-(3-Ethoxypropyl)-N1-(2-furanylmethyl)-1,3-propanediamine is a chemical compound characterized by its unique structure, which includes a propanediamine backbone substituted with both an ethoxypropyl group and a furanylmethyl group. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the furanyl group may impart additional reactivity due to its aromatic nature, potentially allowing for electrophilic substitution reactions. The ethoxy group can enhance the compound's lipophilicity, affecting its interaction with biological systems. Given its structural features, this compound may have applications in medicinal chemistry or as a building block in organic synthesis. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1S/C13H24N2O2/c1-2-16-10-5-9-15(8-4-7-14)12-13-6-3-11-17-13/h3,6,11H,2,4-5,7-10,12,14H2,1H3

InChI key: InChIKey=LHYFPBCXOHOFLS-UHFFFAOYSA-N

SMILES: C(N(CCCOCC)CCCN)C1=CC=CO1

Synonyms:

• 1,3-Propanediamine, N1-(3-ethoxypropyl)-N1-(2-furanylmethyl)-
• N1-(3-Ethoxypropyl)-N1-(2-furanylmethyl)-1,3-propanediamine