CAS 1119450-40-6
:2-Bromo-N-(3,4-dimethoxyphenyl)butanamide
Description:
2-Bromo-N-(3,4-dimethoxyphenyl)butanamide is an organic compound characterized by its specific functional groups and structural features. It contains a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the butanamide moiety indicates that it has an amide functional group, which typically enhances solubility in polar solvents and can influence biological activity. The 3,4-dimethoxyphenyl group suggests that the compound may exhibit interesting electronic properties due to the methoxy substituents, which can affect its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Additionally, the bromine atom can serve as a useful handle for further chemical modifications. Overall, 2-Bromo-N-(3,4-dimethoxyphenyl)butanamide is a compound with unique structural characteristics that may lend itself to various applications in research and industry.
Formula:C12H16BrNO3
InChI:InChI=1S/C12H16BrNO3/c1-4-9(13)12(15)14-8-5-6-10(16-2)11(7-8)17-3/h5-7,9H,4H2,1-3H3,(H,14,15)
InChI key:InChIKey=ITLWQOXMEGNGPB-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(NC(C(CC)Br)=O)=C1
Synonyms:- 2-Bromo-N-(3,4-dimethoxyphenyl)butanamide
- Butanamide, 2-bromo-N-(3,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.