CAS 1119450-41-7

2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)butanamide

Description:

2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)butanamide is a chemical compound characterized by its complex structure, which includes a butanamide moiety and a substituted aromatic ring. The presence of a bromine atom and a chlorine atom in its structure indicates that it is a halogenated compound, which can influence its reactivity and biological activity. The dimethoxy groups on the aromatic ring suggest potential for increased lipophilicity and may affect the compound's interaction with biological targets. This compound may exhibit specific pharmacological properties due to its unique functional groups, making it of interest in medicinal chemistry. Its molecular structure can lead to various applications, particularly in drug development or as a research tool in studying biological pathways. As with many halogenated organic compounds, it is essential to consider its environmental impact and toxicity profile during handling and application. Overall, 2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)butanamide represents a class of compounds that can be valuable in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₅BrClNO₃

InChI: InChI=1S/C12H15BrClNO3/c1-4-7(13)12(16)15-9-5-8(14)10(17-2)6-11(9)18-3/h5-7H,4H2,1-3H3,(H,15,16)

InChI key: InChIKey=UHOKWUICWIWYPH-UHFFFAOYSA-N

SMILES: N(C(C(CC)Br)=O)C1=C(OC)C=C(OC)C(Cl)=C1

Synonyms:

• 2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)butanamide
• Butanamide, 2-bromo-N-(5-chloro-2,4-dimethoxyphenyl)-