CAS 1119450-43-9
:2-Bromo-N-(3-ethylphenyl)butanamide
Description:
2-Bromo-N-(3-ethylphenyl)butanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid and contains a bromine atom at the second carbon position. The presence of the 3-ethylphenyl group indicates that the compound has a phenyl ring substituted with an ethyl group, contributing to its hydrophobic characteristics. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. The bromine atom introduces a halogen, which can influence the compound's reactivity, potentially making it a good candidate for nucleophilic substitution reactions. Additionally, the presence of the amide group suggests that it may participate in hydrogen bonding, affecting its boiling and melting points. Overall, 2-Bromo-N-(3-ethylphenyl)butanamide is a complex molecule with potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C12H16BrNO
InChI:InChI=1S/C12H16BrNO/c1-3-9-6-5-7-10(8-9)14-12(15)11(13)4-2/h5-8,11H,3-4H2,1-2H3,(H,14,15)
InChI key:InChIKey=BGHIPYYCDXBKPA-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=CC(CC)=CC=C1
Synonyms:- Butanamide, 2-bromo-N-(3-ethylphenyl)-
- 2-Bromo-N-(3-ethylphenyl)butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.