CAS 1119450-44-0
:2-Bromo-N-(3,5-dimethoxyphenyl)butanamide
Description:
2-Bromo-N-(3,5-dimethoxyphenyl)butanamide is a chemical compound characterized by its specific functional groups and structural features. It contains a butanamide backbone, which is an amide derived from butanoic acid, and is substituted with a bromine atom at the second carbon position. The presence of a 3,5-dimethoxyphenyl group indicates that the compound has two methoxy (-OCH₃) groups attached to a phenyl ring, enhancing its lipophilicity and potentially influencing its biological activity. This compound may exhibit interesting pharmacological properties due to its structural characteristics, making it a subject of interest in medicinal chemistry. Its molecular interactions could be influenced by the bromine atom and the methoxy substituents, which can affect solubility, reactivity, and binding affinity to biological targets. As with many organic compounds, the stability, reactivity, and potential applications of 2-Bromo-N-(3,5-dimethoxyphenyl)butanamide would depend on its specific environment and conditions. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C12H16BrNO3
InChI:InChI=1S/C12H16BrNO3/c1-4-11(13)12(15)14-8-5-9(16-2)7-10(6-8)17-3/h5-7,11H,4H2,1-3H3,(H,14,15)
InChI key:InChIKey=DZRDLYBJLSXFMK-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=CC(OC)=CC(OC)=C1
Synonyms:- Butanamide, 2-bromo-N-(3,5-dimethoxyphenyl)-
- 2-Bromo-N-(3,5-dimethoxyphenyl)butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.