CAS 1119450-46-2
:2-Bromo-N-[2-(4-chlorophenyl)ethyl]propanamide
Description:
2-Bromo-N-[2-(4-chlorophenyl)ethyl]propanamide is a chemical compound characterized by its structural features, which include a bromine atom and a chlorophenyl group attached to a propanamide backbone. This compound belongs to the class of amides, which are derivatives of carboxylic acids where the hydroxyl group is replaced by an amine or ammonia. The presence of the bromine and chlorine substituents contributes to its potential reactivity and biological activity. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential pharmacological effects. The molecular structure suggests that it may interact with biological targets, making it of interest in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the halogen substituents, which can affect its behavior in various chemical environments. Safety and handling precautions are essential when working with halogenated compounds due to their potential toxicity and environmental impact.
Formula:C11H13BrClNO
InChI:InChI=1S/C11H13BrClNO/c1-8(12)11(15)14-7-6-9-2-4-10(13)5-3-9/h2-5,8H,6-7H2,1H3,(H,14,15)
InChI key:InChIKey=ZRIKJWRPOBCYNI-UHFFFAOYSA-N
SMILES:C(CNC(C(Br)C)=O)C1=CC=C(Cl)C=C1
Synonyms:- Propanamide, 2-bromo-N-[2-(4-chlorophenyl)ethyl]-
- 2-Bromo-N-[2-(4-chlorophenyl)ethyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.