CAS 1119450-47-3

Butanamide, 2-bromo-N-propyl-

Description:

Butanamide, 2-bromo-N-propyl- is an organic compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a bromine atom at the second carbon position indicates that it is a bromo-substituted derivative, while the N-propyl group suggests that a propyl chain is attached to the nitrogen atom of the amide. This compound is likely to exhibit properties typical of amides, such as moderate polarity due to the carbonyl group, which can engage in hydrogen bonding. The bromine substitution may influence its reactivity, making it more susceptible to nucleophilic substitution reactions. Additionally, the molecular structure suggests potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would depend on the overall molecular structure and interactions among its functional groups. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₇H₁₄BrNO

InChI: InChI=1S/C7H14BrNO/c1-3-5-9-7(10)6(8)4-2/h6H,3-5H2,1-2H3,(H,9,10)

InChI key: InChIKey=PMPILFKTSYNCDL-UHFFFAOYSA-N

SMILES: C(C(CC)Br)(NCCC)=O

Synonyms:

• Butanamide, 2-bromo-N-propyl-
• 2-Bromo-N-propylbutanamide