CymitQuimica logo

CAS 1119450-52-0

:

1-[6-(3-Fluorophenyl)-3-pyridazinyl]-4-piperidinecarboxylic acid

Description:
1-[6-(3-Fluorophenyl)-3-pyridazinyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring, a pyridazine moiety, and a fluorophenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents depending on its specific functional groups. The presence of the fluorine atom may enhance its lipophilicity and influence its biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group suggests that it can participate in hydrogen bonding and may exhibit acidic behavior, which could affect its reactivity and interactions with other molecules. Additionally, the compound may have specific applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. Its unique structural features contribute to its potential as a lead compound in drug discovery, particularly in areas related to neuropharmacology or oncology.
Formula:C16H16FN3O2
InChI:InChI=1S/C16H16FN3O2/c17-13-3-1-2-12(10-13)14-4-5-15(19-18-14)20-8-6-11(7-9-20)16(21)22/h1-5,10-11H,6-9H2,(H,21,22)
InChI key:InChIKey=VNKFYDVYKILQCT-UHFFFAOYSA-N
SMILES:FC=1C=C(C2=CC=C(N=N2)N3CCC(C(O)=O)CC3)C=CC1
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-[6-(3-fluorophenyl)-3-pyridazinyl]-
  • 1-[6-(3-Fluorophenyl)-3-pyridazinyl]-4-piperidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.