CAS 1119450-66-6

N-[(2,4-Dichlorophenyl)methyl]-N-(3-nitrophenyl)acetamide

Description:

N-[(2,4-Dichlorophenyl)methyl]-N-(3-nitrophenyl)acetamide is a chemical compound characterized by its complex structure, which includes a dichlorophenyl group and a nitrophenyl group attached to an acetamide moiety. This compound typically exhibits properties associated with both aromatic and amide functionalities, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group suggests that it may possess significant electron-withdrawing characteristics, influencing its reactivity and solubility in different solvents. Additionally, the dichlorophenyl group may enhance its biological activity or stability. The compound's molecular interactions can be influenced by hydrogen bonding due to the amide functional group, which may play a role in its biological efficacy. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research, particularly in the context of its potential applications in medicinal chemistry or as a synthetic intermediate.

Formula: C₁₅H₁₂Cl₂N₂O₃

InChI: InChI=1S/C15H12Cl2N2O3/c1-10(20)18(9-11-5-6-12(16)7-15(11)17)13-3-2-4-14(8-13)19(21)22/h2-8H,9H2,1H3

InChI key: InChIKey=KZNKWZJZUDWQLY-UHFFFAOYSA-N

SMILES: N(CC1=C(Cl)C=C(Cl)C=C1)(C(C)=O)C2=CC(N(=O)=O)=CC=C2

Synonyms:

• N-[(2,4-Dichlorophenyl)methyl]-N-(3-nitrophenyl)acetamide
• Acetamide, N-[(2,4-dichlorophenyl)methyl]-N-(3-nitrophenyl)-