CAS 1119450-79-1
:3-[5-(Phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde
Description:
3-[5-(Phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde is a chemical compound characterized by its unique structure, which includes a benzaldehyde moiety and an oxadiazole ring. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The phenoxymethyl group enhances the compound's solubility and may influence its reactivity and interaction with biological targets. This compound is likely to exhibit properties such as moderate to high stability under standard conditions, and it may participate in various chemical reactions typical of aldehydes, such as nucleophilic addition. Its specific applications could range from medicinal chemistry to materials science, depending on its reactivity and biological activity. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of the compound would need to be assessed in detail. Overall, 3-[5-(Phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde represents a class of compounds with potential utility in research and development.
Formula:C16H12N2O3
InChI:InChI=1S/C16H12N2O3/c19-10-12-5-4-6-13(9-12)16-17-15(21-18-16)11-20-14-7-2-1-3-8-14/h1-10H,11H2
InChI key:InChIKey=LYGAWYUALHLDSK-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C2=NC(=NO2)C3=CC(C=O)=CC=C3
Synonyms:- 3-[5-(Phenoxymethyl)-1,2,4-oxadiazol-3-yl]benzaldehyde
- Benzaldehyde, 3-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.