CymitQuimica logo

CAS 1119450-81-5

:

3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(cyclohexylmethyl)benzamide

Description:
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(cyclohexylmethyl)benzamide, with the CAS number 1119450-81-5, is a chemical compound characterized by its unique structural features, which include a benzamide moiety and an oxadiazole ring. The presence of the chloromethyl group enhances its reactivity, potentially allowing for further chemical modifications. This compound is likely to exhibit properties typical of both aromatic amides and heterocyclic compounds, such as moderate solubility in organic solvents and potential bioactivity. The cyclohexylmethyl substituent may contribute to its lipophilicity, influencing its interaction with biological systems. Additionally, the oxadiazole ring is known for its applications in pharmaceuticals and agrochemicals, often associated with antimicrobial and anti-inflammatory activities. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical determination or literature reference for precise values. Overall, this compound represents a class of organic molecules with potential applications in medicinal chemistry and materials science.
Formula:C17H20ClN3O2
InChI:InChI=1S/C17H20ClN3O2/c18-10-15-20-16(21-23-15)13-7-4-8-14(9-13)17(22)19-11-12-5-2-1-3-6-12/h4,7-9,12H,1-3,5-6,10-11H2,(H,19,22)
InChI key:InChIKey=ZBYPUNXFMLRTDI-UHFFFAOYSA-N
SMILES:C(NCC1CCCCC1)(=O)C=2C=C(C=CC2)C=3N=C(CCl)ON3
Synonyms:
  • 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(cyclohexylmethyl)benzamide
  • Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(cyclohexylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.