CAS 1119450-82-6

3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(2-pyridinylmethyl)benzamide

Description:

3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(2-pyridinylmethyl)benzamide is a chemical compound characterized by its complex structure, which includes an oxadiazole ring and a benzamide moiety. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The oxadiazole ring contributes to its heterocyclic nature, which can impart unique electronic properties and biological activity. The pyridine group in the structure may influence its solubility and interaction with biological targets, suggesting potential applications in medicinal chemistry. This compound may exhibit antimicrobial, antifungal, or anticancer properties, although specific biological activities would require empirical investigation. Its molecular weight, solubility, and stability under various conditions are also important characteristics that would affect its practical applications. As with many synthetic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can pose health risks. Overall, this compound represents a class of heterocyclic compounds with potential utility in pharmaceuticals and agrochemicals.

Formula: C₁₆H₁₃ClN₄O₂

InChI: InChI=1S/C16H13ClN4O2/c17-9-14-20-15(21-23-14)11-4-3-5-12(8-11)16(22)19-10-13-6-1-2-7-18-13/h1-8H,9-10H2,(H,19,22)

InChI key: InChIKey=BTVMZLWTOAIYRZ-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=N1)(=O)C=2C=C(C=CC2)C=3N=C(CCl)ON3

Synonyms:

• 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(2-pyridinylmethyl)benzamide
• Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(2-pyridinylmethyl)-
• 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)benzamide