CAS 1119450-84-8
:4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(phenylmethyl)benzamide
Description:
4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(phenylmethyl)benzamide is a chemical compound characterized by its complex structure, which includes an oxadiazole ring and a benzamide moiety. The presence of the chloromethyl group suggests potential reactivity, making it a candidate for further chemical modifications. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability under standard conditions and potential solubility in organic solvents. Its oxadiazole component may impart biological activity, as oxadiazoles are often explored for their pharmacological properties. The phenylmethyl group can enhance lipophilicity, potentially influencing the compound's interaction with biological systems. Overall, this substance may be of interest in medicinal chemistry and material science, particularly in the development of new pharmaceuticals or agrochemicals. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical determination or literature reference for precise characterization.
Formula:C17H14ClN3O2
InChI:InChI=1S/C17H14ClN3O2/c18-10-15-20-16(21-23-15)13-6-8-14(9-7-13)17(22)19-11-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,22)
InChI key:InChIKey=DXJKTWHZURGGAT-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC(=NO1)C2=CC=C(C(NCC3=CC=CC=C3)=O)C=C2
Synonyms:- Benzamide, 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(phenylmethyl)-
- 4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(phenylmethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.