CAS 1119450-87-1

2-Chloro-3-[(2-methoxyphenyl)methyl]pyrazine

Description:

2-Chloro-3-[(2-methoxyphenyl)methyl]pyrazine is an organic compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chloro group at the 2-position and a methoxyphenylmethyl substituent at the 3-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the methoxy group, which can engage in hydrogen bonding and influence solubility in various solvents. The chloro substituent may also impart specific reactivity, making it a potential candidate for further chemical transformations. In terms of applications, compounds with similar structures are often explored in medicinal chemistry for their biological activities, including antimicrobial or anticancer properties. Additionally, the presence of both aromatic and heterocyclic components suggests potential utility in materials science or as intermediates in organic synthesis. Overall, 2-Chloro-3-[(2-methoxyphenyl)methyl]pyrazine represents a versatile structure with potential implications in various fields of chemistry.

Formula: C₁₂H₁₁ClN₂O

InChI: InChI=1S/C12H11ClN2O/c1-16-11-5-3-2-4-9(11)8-10-12(13)15-7-6-14-10/h2-7H,8H2,1H3

InChI key: InChIKey=CYWOVNRUTNABEU-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC=C1)C=2C(Cl)=NC=CN2

Synonyms:

• 2-Chloro-3-[(2-methoxyphenyl)methyl]pyrazine
• Pyrazine, 2-chloro-3-[(2-methoxyphenyl)methyl]-