CAS 1119450-92-8
:3-[[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]methyl]-1,2,4-oxadiazole-5-carboxylic acid
Description:
3-[[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]methyl]-1,2,4-oxadiazole-5-carboxylic acid is a chemical compound characterized by its complex structure, which includes a thiadiazole and an oxadiazole moiety. The presence of the thiol group contributes to its potential reactivity, while the carboxylic acid functional group indicates acidic properties, allowing for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity due to its heterocyclic nature, which is often associated with pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or anti-inflammatory agents. The compound's stability, solubility, and reactivity can be influenced by the substituents on the thiadiazole ring and the overall electronic distribution within the molecule. As with many heterocyclic compounds, its synthesis and characterization would require careful consideration of reaction conditions and purification methods to ensure the desired purity and yield.
Formula:C7H6N4O3S2
InChI:InChI=1S/C7H6N4O3S2/c1-3-9-10-7(16-3)15-2-4-8-5(6(12)13)14-11-4/h2H2,1H3,(H,12,13)
InChI key:InChIKey=OHZRLHPWMKQTPJ-UHFFFAOYSA-N
SMILES:C(SC=1SC(C)=NN1)C=2N=C(C(O)=O)ON2
Synonyms:- 1,2,4-Oxadiazole-5-carboxylic acid, 3-[[(5-methyl-1,3,4-thiadiazol-2-yl)thio]methyl]-
- 3-[[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]methyl]-1,2,4-oxadiazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.