CymitQuimica logo

CAS 1119450-96-2

:

3-[[(4-Amino-5-ethyl-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxybenzaldehyde

Description:
3-[[(4-Amino-5-ethyl-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxybenzaldehyde is a chemical compound characterized by its complex structure, which includes a triazole ring, an aldehyde functional group, and a methoxy group. The presence of the triazole moiety suggests potential biological activity, as triazoles are often found in pharmaceuticals and agrochemicals. The compound features a thioether linkage, which can enhance its reactivity and solubility in various solvents. The methoxy group contributes to the compound's electronic properties, potentially influencing its reactivity and interaction with biological targets. This compound may exhibit properties such as antimicrobial or antifungal activity, typical of many triazole derivatives. Its specific applications and behavior in chemical reactions would depend on the context of its use, including the presence of other functional groups and the overall molecular environment. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature.
Formula:C13H16N4O2S
InChI:InChI=1S/C13H16N4O2S/c1-3-12-15-16-13(17(12)14)20-8-10-6-9(7-18)4-5-11(10)19-2/h4-7H,3,8,14H2,1-2H3
InChI key:InChIKey=QTVIXRPBYVTZKL-UHFFFAOYSA-N
SMILES:C(SC=1N(N)C(CC)=NN1)C2=C(OC)C=CC(C=O)=C2
Synonyms:
  • Benzaldehyde, 3-[[(4-amino-5-ethyl-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxy-
  • 3-[[(4-Amino-5-ethyl-4H-1,2,4-triazol-3-yl)thio]methyl]-4-methoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.