CAS 1119450-99-5

3-[3-(1H-Imidazol-1-ylmethyl)-4-methoxyphenyl]-2-propenoic acid

Description:

3-[3-(1H-Imidazol-1-ylmethyl)-4-methoxyphenyl]-2-propenoic acid, with the CAS number 1119450-99-5, is a chemical compound characterized by its unique structural features, which include an imidazole ring and a methoxy-substituted phenyl group. This compound is likely to exhibit properties typical of both aromatic and carboxylic acid functionalities, such as potential acidity due to the carboxylic acid group and the ability to participate in hydrogen bonding due to the presence of the imidazole moiety. The methoxy group may influence its solubility and reactivity, potentially enhancing lipophilicity. Additionally, the imidazole ring can contribute to biological activity, making this compound of interest in medicinal chemistry. Its structural complexity suggests that it may interact with biological targets, possibly serving as a lead compound in drug development. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₄N₂O₃

InChI: InChI=1S/C14H14N2O3/c1-19-13-4-2-11(3-5-14(17)18)8-12(13)9-16-7-6-15-10-16/h2-8,10H,9H2,1H3,(H,17,18)

InChI key: InChIKey=CGKHUVNPONYDDE-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(C=CC(O)=O)=C1)N2C=CN=C2

Synonyms:

• 3-[3-(1H-Imidazol-1-ylmethyl)-4-methoxyphenyl]-2-propenoic acid
• 2-Propenoic acid, 3-[3-(1H-imidazol-1-ylmethyl)-4-methoxyphenyl]-