CAS 1119451-02-3
:3-[3-[[(3,5-Dimethyl-4-isoxazolyl)methoxy]methyl]-4-methoxyphenyl]-2-propenoic acid
Description:
3-[3-[[(3,5-Dimethyl-4-isoxazolyl)methoxy]methyl]-4-methoxyphenyl]-2-propenoic acid is a chemical compound characterized by its complex structure, which includes an isoxazole ring, methoxy groups, and a propenoic acid moiety. The presence of the isoxazole ring contributes to its potential biological activity, as such heterocycles are often found in pharmaceuticals. The methoxy groups enhance the compound's lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit properties such as anti-inflammatory or analgesic effects, typical of many derivatives containing similar functional groups. Its molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, including esterification or amidation, which could be relevant for further synthetic modifications or applications in drug development. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C17H19NO5
InChI:InChI=1S/C17H19NO5/c1-11-15(12(2)23-18-11)10-22-9-14-8-13(5-7-17(19)20)4-6-16(14)21-3/h4-8H,9-10H2,1-3H3,(H,19,20)
InChI key:InChIKey=SFQQHPKWSUMXKQ-UHFFFAOYSA-N
SMILES:C(OCC=1C(C)=NOC1C)C2=C(OC)C=CC(C=CC(O)=O)=C2
Synonyms:- 3-[3-[[(3,5-Dimethyl-4-isoxazolyl)methoxy]methyl]-4-methoxyphenyl]-2-propenoic acid
- 2-Propenoic acid, 3-[3-[[(3,5-dimethyl-4-isoxazolyl)methoxy]methyl]-4-methoxyphenyl]-
- (2E)-3-(3-{[(3,5-dimethylisoxazol-4-yl)methoxy]methyl}-4-methoxyphenyl)acrylic acid
- 3-(3-(((3,5-Dimethylisoxazol-4-yl)methoxy)methyl)-4-methoxyphenyl)acrylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.