CAS 1119451-04-5: 1,5,6,7-Tetrahydro-4H-indazol-4-one oxime
Description:1,5,6,7-Tetrahydro-4H-indazol-4-one oxime is a chemical compound characterized by its unique structure, which includes an indazole core with a tetrahydro configuration and an oxime functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the oxime group suggests that it may participate in reactions typical of oximes, such as condensation or rearrangement reactions. Additionally, the tetrahydro configuration indicates that the compound may have a degree of rigidity in its structure, which can influence its reactivity and interaction with biological targets. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with many organic compounds, safety and handling precautions should be observed, as the biological activity and toxicity profiles can vary significantly based on the specific structure and substituents present.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c11-10-7-3-1-2-6-5(7)4-8-9-6/h4,11H,1-3H2,(H,8,9)
InChI key:InChIKey=DKJCYDCGHWJARD-UHFFFAOYSA-N
SMILES:ON=C1C=2C=NNC2CCC1
- Synonyms:
- 4H-Indazol-4-one, 1,5,6,7-tetrahydro-, oxime
- 1,5,6,7-Tetrahydro-4H-indazol-4-one oxime
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (4Z)-1,5,6,7-Tetrahydro-4H-indazol-4-one oxime REF: 3D-FT116685CAS: 1119451-04-5 | Min. 95% | - - - | Discontinued product |

(4Z)-1,5,6,7-Tetrahydro-4H-indazol-4-one oxime
Ref: 3D-FT116685
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |