CAS 1119451-10-3

3-(3-Pyridinyl)-1,2,4-oxadiazole-5-methanol

Description:

3-(3-Pyridinyl)-1,2,4-oxadiazole-5-methanol is a chemical compound characterized by its unique structure, which includes a pyridine ring and an oxadiazole moiety. The presence of the oxadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. The methanol group attached to the oxadiazole enhances its solubility and reactivity, making it a candidate for further chemical modifications. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, which are common in heterocyclic compounds containing nitrogen. Its molecular structure allows for interactions with biological targets, potentially leading to therapeutic applications. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Further research is necessary to fully elucidate its biological properties and potential applications in medicinal chemistry.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c12-5-7-10-8(11-13-7)6-2-1-3-9-4-6/h1-4,12H,5H2

InChI key: InChIKey=TXGJQRAXYKPEMF-UHFFFAOYSA-N

SMILES: C(O)C1=NC(=NO1)C=2C=CC=NC2

Synonyms:

• 3-(3-Pyridinyl)-1,2,4-oxadiazole-5-methanol
• 1,2,4-Oxadiazole-5-methanol, 3-(3-pyridinyl)-

[3-(3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanol

CAS: 1119451-10-3

Formula: C₈H₇N₃O₂

Purity: 95.0%

Molecular weight: 177.163

Ref: 10-F311545