CAS 1119451-11-4

6,7-Dimethyl-1H-benzimidazole-2-methanamine

Description:

6,7-Dimethyl-1H-benzimidazole-2-methanamine is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with two methyl groups at the 6 and 7 positions, and a methanamine group at the 2 position. This compound is part of a class of heterocyclic compounds known for their diverse biological activities, including potential applications in pharmaceuticals. The presence of the benzimidazole moiety often contributes to its ability to interact with biological targets, making it of interest in medicinal chemistry. The methyl substitutions can influence the compound's solubility, stability, and reactivity, which are critical factors in drug design. Additionally, the amine functional group can participate in hydrogen bonding, enhancing its potential interactions with biomolecules. Overall, 6,7-Dimethyl-1H-benzimidazole-2-methanamine exhibits characteristics that may be leveraged in various chemical and biological applications, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₀H₁₃N₃

InChI: InChI=1S/C10H13N3/c1-6-3-4-8-10(7(6)2)13-9(5-11)12-8/h3-4H,5,11H2,1-2H3,(H,12,13)

InChI key: InChIKey=GVVHWCQLKPLUNZ-UHFFFAOYSA-N

SMILES: CC1=C2C(N=C(CN)N2)=CC=C1C

Synonyms:

• 6,7-Dimethyl-1H-benzimidazole-2-methanamine
• 1H-Benzimidazole-2-methanamine, 6,7-dimethyl-
• (6,7-Dimethyl-1H-1,3-benzodiazol-2-yl)methanamine
• (4,5-Dimethyl-1H-benzimidazol-2-yl)methylamine
• (4,5-Dimethyl-1H-1,3-benzodiazol-2-yl)methanamine