CAS 1119451-16-9
:4-[[4-Methyl-2-(1-pyrrolidinyl)-6-quinolinyl]amino]-4-oxobutanoic acid
Description:
4-[[4-Methyl-2-(1-pyrrolidinyl)-6-quinolinyl]amino]-4-oxobutanoic acid, identified by its CAS number 1119451-16-9, is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a pyrrolidine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The oxobutanoic acid component indicates potential acidity, which could affect its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including anti-cancer or anti-inflammatory activities, due to their ability to interact with various biological pathways. Additionally, the structural features may allow for modifications that enhance efficacy or reduce toxicity, making it a candidate for further research in medicinal chemistry. As with many synthetic compounds, understanding its stability, solubility, and reactivity is crucial for potential applications in drug development.
Formula:C18H21N3O3
InChI:InChI=1S/C18H21N3O3/c1-12-10-16(21-8-2-3-9-21)20-15-5-4-13(11-14(12)15)19-17(22)6-7-18(23)24/h4-5,10-11H,2-3,6-9H2,1H3,(H,19,22)(H,23,24)
InChI key:InChIKey=NUZKOTZNMRMDJO-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(C1)N3CCCC3)C=CC(NC(CCC(O)=O)=O)=C2
Synonyms:- 4-[[4-Methyl-2-(1-pyrrolidinyl)-6-quinolinyl]amino]-4-oxobutanoic acid
- Butanoic acid, 4-[[4-methyl-2-(1-pyrrolidinyl)-6-quinolinyl]amino]-4-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.