CymitQuimica logo

CAS 1119451-18-1

:

4-[3-[[Methyl(1-methylpropyl)amino]methyl]phenyl]-4-piperidinol

Description:
4-[3-[[Methyl(1-methylpropyl)amino]methyl]phenyl]-4-piperidinol is a chemical compound characterized by its complex structure, which includes a piperidine ring and a phenyl group substituted with a methyl(1-methylpropyl)amino moiety. This compound typically exhibits properties associated with amines and alcohols, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the hydroxyl group. Its molecular structure suggests it may have biological activity, possibly interacting with neurotransmitter systems, given the piperidine and amine functionalities. The compound's specific applications or effects would depend on its pharmacological profile, which would require further investigation through experimental studies. Additionally, safety and handling considerations are essential, as with any chemical substance, to mitigate risks associated with exposure or reactivity. Overall, 4-[3-[[Methyl(1-methylpropyl)amino]methyl]phenyl]-4-piperidinol represents a unique entity within the realm of organic chemistry, with potential implications in medicinal chemistry and drug development.
Formula:C17H28N2O
InChI:InChI=1S/C17H28N2O/c1-4-14(2)19(3)13-15-6-5-7-16(12-15)17(20)8-10-18-11-9-17/h5-7,12,14,18,20H,4,8-11,13H2,1-3H3
InChI key:InChIKey=VLOFATMPYBXDQB-UHFFFAOYSA-N
SMILES:OC1(CCNCC1)C2=CC(CN(C(CC)C)C)=CC=C2
Synonyms:
  • 4-[3-[[Methyl(1-methylpropyl)amino]methyl]phenyl]-4-piperidinol
  • 4-Piperidinol, 4-[3-[[methyl(1-methylpropyl)amino]methyl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.