CymitQuimica logo

CAS 1119451-23-8

:

2-Bromo-N-(2-methoxyethyl)-N-methylbenzenemethanamine

Description:
2-Bromo-N-(2-methoxyethyl)-N-methylbenzenemethanamine is an organic compound characterized by its complex structure, which includes a bromine atom, a methoxyethyl group, and a methyl group attached to a benzenemethanamine backbone. This compound features a bromine substituent that can influence its reactivity and solubility, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The methoxyethyl group contributes to the compound's polarity, enhancing its solubility in polar solvents. The presence of the amine functional group indicates that it can act as a base and participate in hydrogen bonding, which may affect its interactions with biological systems or other chemical species. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific properties such as melting point, boiling point, and spectral characteristics would require experimental determination or detailed literature references for comprehensive understanding.
Formula:C11H16BrNO
InChI:InChI=1S/C11H16BrNO/c1-13(7-8-14-2)9-10-5-3-4-6-11(10)12/h3-6H,7-9H2,1-2H3
InChI key:InChIKey=JBQACUJJCAEOPQ-UHFFFAOYSA-N
SMILES:C(N(CCOC)C)C1=C(Br)C=CC=C1
Synonyms:
  • Benzenemethanamine, 2-bromo-N-(2-methoxyethyl)-N-methyl-
  • 2-Bromo-N-(2-methoxyethyl)-N-methylbenzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.