CAS 1119451-35-2
:β-Amino-2-methoxy-4-(1-methylethoxy)benzenepropanoic acid
Description:
β-Amino-2-methoxy-4-(1-methylethoxy)benzenepropanoic acid, identified by its CAS number 1119451-35-2, is a chemical compound that features a benzene ring substituted with various functional groups, including an amino group and methoxy and ethoxy side chains. This compound is characterized by its potential biological activity, which may include interactions with neurotransmitter systems or other biochemical pathways. The presence of the amino group suggests it may exhibit basic properties, while the methoxy and ethoxy groups can influence its solubility and reactivity. The molecular structure indicates that it may participate in hydrogen bonding, affecting its physical properties such as melting point and boiling point. Additionally, the compound's unique substituents may confer specific pharmacological properties, making it of interest in medicinal chemistry. Overall, β-Amino-2-methoxy-4-(1-methylethoxy)benzenepropanoic acid represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C13H19NO4
InChI:InChI=1S/C13H19NO4/c1-8(2)18-9-4-5-10(12(6-9)17-3)11(14)7-13(15)16/h4-6,8,11H,7,14H2,1-3H3,(H,15,16)
InChI key:InChIKey=MKXAHDLJNBAKKN-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(CC(O)=O)N)C=CC(OC(C)C)=C1
Synonyms:- Benzenepropanoic acid, β-amino-2-methoxy-4-(1-methylethoxy)-
- β-Amino-2-methoxy-4-(1-methylethoxy)benzenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.