CymitQuimica logo

CAS 1119451-36-3

:

3-[2-Methoxy-4-(1-methylethoxy)phenyl]-2-propenoic acid

Description:
3-[2-Methoxy-4-(1-methylethoxy)phenyl]-2-propenoic acid, identified by its CAS number 1119451-36-3, is an organic compound characterized by its unique structure that includes a propenoic acid moiety and a substituted phenyl group. This compound features a methoxy group and an isopropoxy substituent on the aromatic ring, which contribute to its chemical reactivity and solubility properties. The presence of the propenoic acid functional group indicates that it can participate in various chemical reactions, such as esterification and polymerization. Its molecular structure suggests potential applications in fields such as organic synthesis, materials science, and possibly in pharmaceuticals, given the presence of functional groups that can interact with biological systems. Additionally, the compound's solubility in organic solvents and its stability under standard conditions make it a candidate for further research and development in various chemical applications. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C13H16O4
InChI:InChI=1S/C13H16O4/c1-9(2)17-11-6-4-10(5-7-13(14)15)12(8-11)16-3/h4-9H,1-3H3,(H,14,15)
InChI key:InChIKey=WQLNUTUUAVRGAR-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(O)=O)C=CC(OC(C)C)=C1
Synonyms:
  • 3-[2-Methoxy-4-(1-methylethoxy)phenyl]-2-propenoic acid
  • 2-Propenoic acid, 3-[2-methoxy-4-(1-methylethoxy)phenyl]-
  • 4-Isopropoxy-2-methoxycinnamic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.