CAS 1119451-42-1
:2-Bromo-N-(3-chloro-4-methoxyphenyl)butanamide
Description:
2-Bromo-N-(3-chloro-4-methoxyphenyl)butanamide is a chemical compound characterized by its specific functional groups and structural features. It contains a butanamide backbone, which is an amide derived from butanoic acid, indicating the presence of a carbonyl group (C=O) linked to a nitrogen atom (N). The compound also features a bromo substituent, which introduces a bromine atom into the structure, enhancing its reactivity and potential applications in organic synthesis. Additionally, the presence of a chloro group and a methoxy group on the phenyl ring contributes to its unique electronic properties and steric effects, which can influence its biological activity and interactions. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, and its specific substitutions may affect its solubility, stability, and reactivity. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.
Formula:C11H13BrClNO2
InChI:InChI=1S/C11H13BrClNO2/c1-3-8(12)11(15)14-7-4-5-10(16-2)9(13)6-7/h4-6,8H,3H2,1-2H3,(H,14,15)
InChI key:InChIKey=XAAOAWXSNWBFFP-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=CC(Cl)=C(OC)C=C1
Synonyms:- Butanamide, 2-bromo-N-(3-chloro-4-methoxyphenyl)-
- 2-Bromo-N-(3-chloro-4-methoxyphenyl)butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.